C13H14Cl2N4O — CID 107184567
5-amino-2,3-dichloro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide (PubChem CID 107184567) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107184567 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-amino-2,3-dichloro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N4O/c1-18(6-8-5-17-19(2)7-8)13(20)10-3-9(16)4-11(14)12(10)15/h3-5,7H,6,16H2,1-2H3 |
| InChIKey | CPCMIQHIRTWOPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|