C13H17N5O — CID 61139345
3,5-diamino-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide (PubChem CID 61139345) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3,5-diamino-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3,5-diamino-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 61139345 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3,5-diamino-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C13H17N5O/c1-17(7-9-6-16-18(2)8-9)13(19)10-3-11(14)5-12(15)4-10/h3-6,8H,7,14-15H2,1-2H3 |
| InChIKey | YHSZRTMCHROVDM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|