C9H12N4O2S — CID 83205321
2-[(6-carbamothioyl-2-pyridinyl)amino]ethyl carbamate (PubChem CID 83205321) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-[(6-carbamothioyl-2-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(6-carbamothioyl-2-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83205321 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-[(6-carbamothioyl-2-pyridinyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cccc(C(N)=S)n1 |
| InChI | InChI=1S/C9H12N4O2S/c10-8(16)6-2-1-3-7(13-6)12-4-5-15-9(11)14/h1-3H,4-5H2,(H2,10,16)(H2,11,14)(H,12,13) |
| InChIKey | QMLNAVUPNMDSMA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|