C11H18N4O2 — CID 83214804
2-[[6-(propylamino)-2-pyridinyl]amino]ethyl carbamate (PubChem CID 83214804) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[[6-(propylamino)-2-pyridinyl]amino]ethyl carbamate.
| Compound Name | 2-[[6-(propylamino)-2-pyridinyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83214804 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[[6-(propylamino)-2-pyridinyl]amino]ethyl carbamate |
| SMILES | CCCNc1cccc(NCCOC(N)=O)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-2-6-13-9-4-3-5-10(15-9)14-7-8-17-11(12)16/h3-5H,2,6-8H2,1H3,(H2,12,16)(H2,13,14,15) |
| InChIKey | SEOLINRATWYHCU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|