C13H21N5O2 — CID 79230668
2-[(2-amino-2-oxoethyl)-[[6-(propylamino)-2-pyridinyl]methyl]amino]acetamide (PubChem CID 79230668) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[[6-(propylamino)-2-pyridinyl]methyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[[6-(propylamino)-2-pyridinyl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 79230668 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[[6-(propylamino)-2-pyridinyl]methyl]amino]acetamide |
| SMILES | CCCNc1cccc(CN(CC(N)=O)CC(N)=O)n1 |
| InChI | InChI=1S/C13H21N5O2/c1-2-6-16-13-5-3-4-10(17-13)7-18(8-11(14)19)9-12(15)20/h3-5H,2,6-9H2,1H3,(H2,14,19)(H2,15,20)(H,16,17) |
| InChIKey | MNUFZRKZOAEPIU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |