C10H18N6O3 — CID 83215694
2-[[4-methoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl carbamate (PubChem CID 83215694) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[[4-methoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[4-methoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83215694 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[[4-methoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl carbamate |
| SMILES | CCCNc1nc(NCCOC(N)=O)nc(OC)n1 |
| InChI | InChI=1S/C10H18N6O3/c1-3-4-12-8-14-9(16-10(15-8)18-2)13-5-6-19-7(11)17/h3-6H2,1-2H3,(H2,11,17)(H2,12,13,14,15,16) |
| InChIKey | AUWLVUUGOKPMKE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|