C9H14ClN5O3 — CID 83204945
2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]ethyl carbamate (PubChem CID 83204945) has the molecular formula C9H14ClN5O3 and a molecular weight of 275.70 g/mol. Its IUPAC name is 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]ethyl carbamate.
| Compound Name | 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204945 |
| Molecular Formula | C9H14ClN5O3 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]ethyl carbamate |
| SMILES | CCCOc1nc(Cl)nc(NCCOC(N)=O)n1 |
| InChI | InChI=1S/C9H14ClN5O3/c1-2-4-18-9-14-6(10)13-8(15-9)12-3-5-17-7(11)16/h2-5H2,1H3,(H2,11,16)(H,12,13,14,15) |
| InChIKey | KAVBDDMKKLWOCQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|