C9H15N5O2 — CID 106234451
2-[2-[(5,6-diamino-2-pyridinyl)amino]ethoxy]acetamide (PubChem CID 106234451) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[2-[(5,6-diamino-2-pyridinyl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5,6-diamino-2-pyridinyl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106234451 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[2-[(5,6-diamino-2-pyridinyl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C9H15N5O2/c10-6-1-2-8(14-9(6)12)13-3-4-16-5-7(11)15/h1-2H,3-5,10H2,(H2,11,15)(H3,12,13,14) |
| InChIKey | JNOXKKPDYOFNAN-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|