C12H11F3N4 — CID 80652487
2-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazine-2,5-diamine (PubChem CID 80652487) has the molecular formula C12H11F3N4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazine-2,5-diamine.
| Compound Name | 2-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 80652487 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazine-2,5-diamine |
| SMILES | Nc1cnc(NCc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C12H11F3N4/c13-12(14,15)9-3-1-8(2-4-9)5-18-11-7-17-10(16)6-19-11/h1-4,6-7H,5H2,(H2,16,17)(H,18,19) |
| InChIKey | UJGIOZJIDWNRSP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |