C14H13F3N2O2S — CID 511956
5-methylsulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine (PubChem CID 511956) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is 5-methylsulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine.
| Compound Name | 5-methylsulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 511956 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-methylsulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(NCc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C14H13F3N2O2S/c1-22(20,21)12-6-7-13(19-9-12)18-8-10-2-4-11(5-3-10)14(15,16)17/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | OPGVKXSVNLXZHJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |