C16H19BrN4O2 — CID 110187378
3-bromopropyl N-[2-amino-6-(benzylamino)-3-pyridinyl]carbamate (PubChem CID 110187378) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is 3-bromopropyl N-[2-amino-6-(benzylamino)-3-pyridinyl]carbamate.
| Compound Name | 3-bromopropyl N-[2-amino-6-(benzylamino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110187378 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 3-bromopropyl N-[2-amino-6-(benzylamino)-3-pyridinyl]carbamate |
| SMILES | Nc1nc(NCc2ccccc2)ccc1NC(=O)OCCCBr |
| InChI | InChI=1S/C16H19BrN4O2/c17-9-4-10-23-16(22)20-13-7-8-14(21-15(13)18)19-11-12-5-2-1-3-6-12/h1-3,5-8H,4,9-11H2,(H,20,22)(H3,18,19,21) |
| InChIKey | BLDNHPLZQQYCDS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|