C16H16ClFN4O2 — CID 15152218
prop-2-enyl N-[2-amino-6-[(2-chloro-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 15152218) has the molecular formula C16H16ClFN4O2 and a molecular weight of 350.78 g/mol. Its IUPAC name is prop-2-enyl N-[2-amino-6-[(2-chloro-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | prop-2-enyl N-[2-amino-6-[(2-chloro-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 15152218 |
| Molecular Formula | C16H16ClFN4O2 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | prop-2-enyl N-[2-amino-6-[(2-chloro-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccc(NCc2ccc(F)cc2Cl)nc1N |
| InChI | InChI=1S/C16H16ClFN4O2/c1-2-7-24-16(23)21-13-5-6-14(22-15(13)19)20-9-10-3-4-11(18)8-12(10)17/h2-6,8H,1,7,9H2,(H,21,23)(H3,19,20,22) |
| InChIKey | YJOMQBSFGPAOQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|