C13H16N4O3 — CID 110178948
ethyl N-[2-amino-6-(furan-2-ylmethylamino)-3-pyridinyl]carbamate (PubChem CID 110178948) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is ethyl N-[2-amino-6-(furan-2-ylmethylamino)-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-(furan-2-ylmethylamino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110178948 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | ethyl N-[2-amino-6-(furan-2-ylmethylamino)-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccco2)nc1N |
| InChI | InChI=1S/C13H16N4O3/c1-2-19-13(18)16-10-5-6-11(17-12(10)14)15-8-9-4-3-7-20-9/h3-7H,2,8H2,1H3,(H,16,18)(H3,14,15,17) |
| InChIKey | YGMIFMJVXIRZFI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |