C11H12N2O4 — CID 113377062
ethyl 2-(furan-2-ylmethylamino)-1,3-oxazole-4-carboxylate (PubChem CID 113377062) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is ethyl 2-(furan-2-ylmethylamino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(furan-2-ylmethylamino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377062 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | ethyl 2-(furan-2-ylmethylamino)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(NCc2ccco2)n1 |
| InChI | InChI=1S/C11H12N2O4/c1-2-15-10(14)9-7-17-11(13-9)12-6-8-4-3-5-16-8/h3-5,7H,2,6H2,1H3,(H,12,13) |
| InChIKey | AKXULRCIYDVZNZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |