C12H20N2O4 — CID 113377237
ethyl 2-(2-butoxyethylamino)-1,3-oxazole-4-carboxylate (PubChem CID 113377237) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 2-(2-butoxyethylamino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(2-butoxyethylamino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377237 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | ethyl 2-(2-butoxyethylamino)-1,3-oxazole-4-carboxylate |
| SMILES | CCCCOCCNc1nc(C(=O)OCC)co1 |
| InChI | InChI=1S/C12H20N2O4/c1-3-5-7-16-8-6-13-12-14-10(9-18-12)11(15)17-4-2/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | XJNYJYBPNLFRCY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|