C13H15N3O3 — CID 113377147
ethyl 2-(2-pyridin-4-ylethylamino)-1,3-oxazole-4-carboxylate (PubChem CID 113377147) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 2-(2-pyridin-4-ylethylamino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(2-pyridin-4-ylethylamino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377147 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl 2-(2-pyridin-4-ylethylamino)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(NCCc2ccncc2)n1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-18-12(17)11-9-19-13(16-11)15-8-5-10-3-6-14-7-4-10/h3-4,6-7,9H,2,5,8H2,1H3,(H,15,16) |
| InChIKey | XRCWQLKLSUCQEW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |