C11H16N2O3 — CID 106189842
ethyl 2-(3-methylbut-2-enylamino)-1,3-oxazole-4-carboxylate (PubChem CID 106189842) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl 2-(3-methylbut-2-enylamino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(3-methylbut-2-enylamino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 106189842 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | ethyl 2-(3-methylbut-2-enylamino)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(NCC=C(C)C)n1 |
| InChI | InChI=1S/C11H16N2O3/c1-4-15-10(14)9-7-16-11(13-9)12-6-5-8(2)3/h5,7H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | NGWLRFDKJWZJBE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|