C12H14N2O4 — CID 113377130
ethyl 2-[1-(furan-2-yl)ethylamino]-1,3-oxazole-4-carboxylate (PubChem CID 113377130) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl 2-[1-(furan-2-yl)ethylamino]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[1-(furan-2-yl)ethylamino]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377130 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 2-[1-(furan-2-yl)ethylamino]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(NC(C)c2ccco2)n1 |
| InChI | InChI=1S/C12H14N2O4/c1-3-16-11(15)9-7-18-12(14-9)13-8(2)10-5-4-6-17-10/h4-8H,3H2,1-2H3,(H,13,14) |
| InChIKey | ZMMAARPYBAJRQE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |