C13H13ClN2O3 — CID 113377331
ethyl 2-(2-chloro-6-methylanilino)-1,3-oxazole-4-carboxylate (PubChem CID 113377331) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is ethyl 2-(2-chloro-6-methylanilino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(2-chloro-6-methylanilino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377331 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | ethyl 2-(2-chloro-6-methylanilino)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(Nc2c(C)cccc2Cl)n1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-3-18-12(17)10-7-19-13(15-10)16-11-8(2)5-4-6-9(11)14/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | UMQKWGDWALLADM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |