C12H8F4N2O3 — CID 107645105
ethyl 2-(2,3,5,6-tetrafluoroanilino)-1,3-oxazole-4-carboxylate (PubChem CID 107645105) has the molecular formula C12H8F4N2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is ethyl 2-(2,3,5,6-tetrafluoroanilino)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(2,3,5,6-tetrafluoroanilino)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 107645105 |
| Molecular Formula | C12H8F4N2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | ethyl 2-(2,3,5,6-tetrafluoroanilino)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C12H8F4N2O3/c1-2-20-11(19)7-4-21-12(17-7)18-10-8(15)5(13)3-6(14)9(10)16/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | ZSRNZSXPQBBKDQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|