C21H26N2O4S — CID 123733676
tert-butyl 3-[(2-methyl-5-thiophen-2-ylphenyl)carbamoyloxymethyl]azetidine-1-carboxylate (PubChem CID 123733676) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is tert-butyl 3-[(2-methyl-5-thiophen-2-ylphenyl)carbamoyloxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methyl-5-thiophen-2-ylphenyl)carbamoyloxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 123733676 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | tert-butyl 3-[(2-methyl-5-thiophen-2-ylphenyl)carbamoyloxymethyl]azetidine-1-carboxylate |
| SMILES | Cc1ccc(-c2cccs2)cc1NC(=O)OCC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H26N2O4S/c1-14-7-8-16(18-6-5-9-28-18)10-17(14)22-19(24)26-13-15-11-23(12-15)20(25)27-21(2,3)4/h5-10,15H,11-13H2,1-4H3,(H,22,24) |
| InChIKey | FVQDNMBGVYFRKI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |