C24H25BrN2O3S — CID 154433126
tert-butyl N-[2-[[4-(2-bromoethyl)benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 154433126) has the molecular formula C24H25BrN2O3S and a molecular weight of 501.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(2-bromoethyl)benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(2-bromoethyl)benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 154433126 |
| Molecular Formula | C24H25BrN2O3S |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | tert-butyl N-[2-[[4-(2-bromoethyl)benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C24H25BrN2O3S/c1-24(2,3)30-23(29)27-19-11-10-18(21-5-4-14-31-21)15-20(19)26-22(28)17-8-6-16(7-9-17)12-13-25/h4-11,14-15H,12-13H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | VGBOXOGGHZBSCM-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|