C38H38N6O7S2 — CID 91287939
tert-butyl N-[2-[[4-[[(3S)-3-[benzenesulfonyl-(4-nitro-3-pyridinyl)amino]pyrrolidin-1-yl]methyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 91287939) has the molecular formula C38H38N6O7S2 and a molecular weight of 754.89 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[(3S)-3-[benzenesulfonyl-(4-nitro-3-pyridinyl)amino]pyrrolidin-1-yl]methyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[(3S)-3-[benzenesulfonyl-(4-nitro-3-pyridinyl)amino]pyrrolidin-1-yl]methyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 91287939 |
| Molecular Formula | C38H38N6O7S2 |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.22 |
| IUPAC Name | tert-butyl N-[2-[[4-[[(3S)-3-[benzenesulfonyl-(4-nitro-3-pyridinyl)amino]pyrrolidin-1-yl]methyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CN2CC[C@H](N(c3cnccc3[N+](=O)[O-])S(=O)(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C38H38N6O7S2/c1-38(2,3)51-37(46)41-31-16-15-28(35-10-7-21-52-35)22-32(31)40-36(45)27-13-11-26(12-14-27)24-42-20-18-29(25-42)43(34-23-39-19-17-33(34)44(47)48)53(49,50)30-8-5-4-6-9-30/h4-17,19,21-23,29H,18,20,24-25H2,1-3H3,(H,40,45)(H,41,46)/t29-/m0/s1 |
| InChIKey | AFPPXXITNWJDGV-LJAQVGFWSA-N |
| XLogP | 7.79 |
| TPSA | 164.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|