C16H17F3N2O2 — CID 58902477
tert-butyl 2-[3-amino-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate (PubChem CID 58902477) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is tert-butyl 2-[3-amino-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[3-amino-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 58902477 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | tert-butyl 2-[3-amino-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-15(2,3)23-14(22)21-6-4-5-13(21)10-7-11(16(17,18)19)9-12(20)8-10/h4-9H,20H2,1-3H3 |
| InChIKey | XHKRKJUGEWPXMR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|