C32H61NO6Si2 — CID 102499956
tert-butyl 2-[(1S,2R,3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-ethoxy-2,4-dimethyl-7-oxoheptyl]pyrrole-1-carboxylate (PubChem CID 102499956) has the molecular formula C32H61NO6Si2 and a molecular weight of 612.01 g/mol. Its IUPAC name is tert-butyl 2-[(1S,2R,3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-ethoxy-2,4-dimethyl-7-oxoheptyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[(1S,2R,3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-ethoxy-2,4-dimethyl-7-oxoheptyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102499956 |
| Molecular Formula | C32H61NO6Si2 |
| Molecular Weight | 612.01 g/mol |
| Exact Mass | 611.40 |
| IUPAC Name | tert-butyl 2-[(1S,2R,3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-ethoxy-2,4-dimethyl-7-oxoheptyl]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)c1cccn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H61NO6Si2/c1-17-36-26(34)21-20-23(2)27(38-40(13,14)31(7,8)9)24(3)28(39-41(15,16)32(10,11)12)25-19-18-22-33(25)29(35)37-30(4,5)6/h18-19,22-24,27-28H,17,20-21H2,1-16H3/t23-,24+,27+,28-/m0/s1 |
| InChIKey | GFCYFMPQWDNFDR-COHKGRJRSA-N |
| XLogP | 9.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.01 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|