C32H36N2O3 — CID 69334638
tert-butyl 2-[2-(dibenzylamino)-3-hydroxy-3-phenylpropyl]pyrrole-1-carboxylate (PubChem CID 69334638) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is tert-butyl 2-[2-(dibenzylamino)-3-hydroxy-3-phenylpropyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(dibenzylamino)-3-hydroxy-3-phenylpropyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 69334638 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | tert-butyl 2-[2-(dibenzylamino)-3-hydroxy-3-phenylpropyl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1CC(C(O)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H36N2O3/c1-32(2,3)37-31(36)34-21-13-20-28(34)22-29(30(35)27-18-11-6-12-19-27)33(23-25-14-7-4-8-15-25)24-26-16-9-5-10-17-26/h4-21,29-30,35H,22-24H2,1-3H3 |
| InChIKey | OMORWSLRJIVQFI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |