C16H25NO2 — CID 131744647
tert-butyl 2-(cyclohexylmethyl)pyrrole-1-carboxylate (PubChem CID 131744647) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is tert-butyl 2-(cyclohexylmethyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(cyclohexylmethyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 131744647 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | tert-butyl 2-(cyclohexylmethyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1CC1CCCCC1 |
| InChI | InChI=1S/C16H25NO2/c1-16(2,3)19-15(18)17-11-7-10-14(17)12-13-8-5-4-6-9-13/h7,10-11,13H,4-6,8-9,12H2,1-3H3 |
| InChIKey | JXGGCVPHPMZZNC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |