C15H23NO2 — CID 166153519
tert-butyl 2-cyclohexylpyrrole-1-carboxylate (PubChem CID 166153519) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is tert-butyl 2-cyclohexylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-cyclohexylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 166153519 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | tert-butyl 2-cyclohexylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1C1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-15(2,3)18-14(17)16-11-7-10-13(16)12-8-5-4-6-9-12/h7,10-12H,4-6,8-9H2,1-3H3 |
| InChIKey | GDSILJJQEIXMRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |