C25H32N2O4 — CID 87160013
tert-butyl 2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]pyrrole-1-carboxylate (PubChem CID 87160013) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl 2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 87160013 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | tert-butyl 2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]pyrrole-1-carboxylate |
| SMILES | COOCc1ccc2c(C3CCCCC3)c(-c3cccn3C(=O)OC(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C25H32N2O4/c1-25(2,3)31-24(28)27-14-8-11-21(27)23-22(18-9-6-5-7-10-18)19-13-12-17(16-30-29-4)15-20(19)26-23/h8,11-15,18,26H,5-7,9-10,16H2,1-4H3 |
| InChIKey | XAQKJPQNOWHGBF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|