C24H30N2O2 — CID 171968470
tert-butyl 2-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)pyrrole-1-carboxylate (PubChem CID 171968470) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl 2-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 171968470 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tert-butyl 2-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1C1=CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-24(2,3)28-23(27)25-14-8-13-22(25)19-15-20-11-7-12-21(16-19)26(20)17-18-9-5-4-6-10-18/h4-6,8-10,13-15,20-21H,7,11-12,16-17H2,1-3H3 |
| InChIKey | WKGXUHHLSOPGBD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |