C24H26ClFN2O3 — CID 87159993
2-chloro-N-[2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]-4-fluorophenyl]acetamide (PubChem CID 87159993) has the molecular formula C24H26ClFN2O3 and a molecular weight of 444.93 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]-4-fluorophenyl]acetamide.
| Compound Name | 2-chloro-N-[2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 87159993 |
| Molecular Formula | C24H26ClFN2O3 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-chloro-N-[2-[3-cyclohexyl-6-(methylperoxymethyl)-1H-indol-2-yl]-4-fluorophenyl]acetamide |
| SMILES | COOCc1ccc2c(C3CCCCC3)c(-c3cc(F)ccc3NC(=O)CCl)[nH]c2c1 |
| InChI | InChI=1S/C24H26ClFN2O3/c1-30-31-14-15-7-9-18-21(11-15)28-24(23(18)16-5-3-2-4-6-16)19-12-17(26)8-10-20(19)27-22(29)13-25/h7-12,16,28H,2-6,13-14H2,1H3,(H,27,29) |
| InChIKey | VSDHZAKEUYLMIT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|