C46H49ClN2O6 — CID 157150462
methyl 2-[2-(2-chloroethoxy)phenyl]-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-hydroxyphenyl)-1H-indole-6-carboxylate (PubChem CID 157150462) has the molecular formula C46H49ClN2O6 and a molecular weight of 761.36 g/mol. Its IUPAC name is methyl 2-[2-(2-chloroethoxy)phenyl]-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-hydroxyphenyl)-1H-indole-6-carboxylate.
| Compound Name | methyl 2-[2-(2-chloroethoxy)phenyl]-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-hydroxyphenyl)-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 157150462 |
| Molecular Formula | C46H49ClN2O6 |
| Molecular Weight | 761.36 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | methyl 2-[2-(2-chloroethoxy)phenyl]-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-hydroxyphenyl)-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3O)[nH]c2c1.COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3OCCCl)[nH]c2c1 |
| InChI | InChI=1S/C24H26ClNO3.C22H23NO3/c1-28-24(27)17-11-12-18-20(15-17)26-23(22(18)16-7-3-2-4-8-16)19-9-5-6-10-21(19)29-14-13-25;1-26-22(25)15-11-12-16-18(13-15)23-21(17-9-5-6-10-19(17)24)20(16)14-7-3-2-4-8-14/h5-6,9-12,15-16,26H,2-4,7-8,13-14H2,1H3;5-6,9-14,23-24H,2-4,7-8H2,1H3 |
| InChIKey | ALESRTGTNFHERH-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.36 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|