C23H25NO3S — CID 150192995
3-cyclohexyl-2-[2-(2-hydroxyethylsulfanyl)phenyl]-1H-indole-6-carboxylic acid (PubChem CID 150192995) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is 3-cyclohexyl-2-[2-(2-hydroxyethylsulfanyl)phenyl]-1H-indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-2-[2-(2-hydroxyethylsulfanyl)phenyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 150192995 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-cyclohexyl-2-[2-(2-hydroxyethylsulfanyl)phenyl]-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3ccccc3SCCO)[nH]c2c1 |
| InChI | InChI=1S/C23H25NO3S/c25-12-13-28-20-9-5-4-8-18(20)22-21(15-6-2-1-3-7-15)17-11-10-16(23(26)27)14-19(17)24-22/h4-5,8-11,14-15,24-25H,1-3,6-7,12-13H2,(H,26,27) |
| InChIKey | FNVKQBMHHCNSSX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |