C24H25NO2Y-2 — CID 59142823
3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;yttrium (PubChem CID 59142823) has the molecular formula C24H25NO2Y-2 and a molecular weight of 448.38 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;yttrium.
| Compound Name | 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 59142823 |
| Molecular Formula | C24H25NO2Y-2 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;yttrium |
| SMILES | [CH2-]Cn1c(-c2ccccc2[CH2-])c(C2CCCCC2)c2ccc(C(=O)O)cc21.[Y] |
| InChI | InChI=1S/C24H25NO2.Y/c1-3-25-21-15-18(24(26)27)13-14-20(21)22(17-10-5-4-6-11-17)23(25)19-12-8-7-9-16(19)2;/h7-9,12-15,17H,1-6,10-11H2,(H,26,27);/q-2; |
| InChIKey | QFVKPQVZSMKJLC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|