C47H48N2O4 — CID 157061369
12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid;methyl 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylate (PubChem CID 157061369) has the molecular formula C47H48N2O4 and a molecular weight of 704.91 g/mol. Its IUPAC name is 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid;methyl 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylate.
| Compound Name | 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid;methyl 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylate |
|---|---|
| PubChem CID | 157061369 |
| Molecular Formula | C47H48N2O4 |
| Molecular Weight | 704.91 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid;methyl 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCc1ccccc1-3.O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCc1ccccc1-3 |
| InChI | InChI=1S/C24H25NO2.C23H23NO2/c1-27-24(26)18-11-12-20-21(15-18)25-14-13-16-7-5-6-10-19(16)23(25)22(20)17-8-3-2-4-9-17;25-23(26)17-10-11-19-20(14-17)24-13-12-15-6-4-5-9-18(15)22(24)21(19)16-7-2-1-3-8-16/h5-7,10-12,15,17H,2-4,8-9,13-14H2,1H3;4-6,9-11,14,16H,1-3,7-8,12-13H2,(H,25,26) |
| InChIKey | ABJHNSYVLIJRAN-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.91 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |