C23H23NO3 — CID 11552259
methyl 11-cyclohexyl-6-hydroxy-6H-isoindolo[2,1-a]indole-3-carboxylate (PubChem CID 11552259) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl 11-cyclohexyl-6-hydroxy-6H-isoindolo[2,1-a]indole-3-carboxylate.
| Compound Name | methyl 11-cyclohexyl-6-hydroxy-6H-isoindolo[2,1-a]indole-3-carboxylate |
|---|---|
| PubChem CID | 11552259 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl 11-cyclohexyl-6-hydroxy-6H-isoindolo[2,1-a]indole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)C(O)c1ccccc1-3 |
| InChI | InChI=1S/C23H23NO3/c1-27-23(26)15-11-12-18-19(13-15)24-21(20(18)14-7-3-2-4-8-14)16-9-5-6-10-17(16)22(24)25/h5-6,9-14,22,25H,2-4,7-8H2,1H3 |
| InChIKey | NJLVAQGJZOXDRY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |