C26H30N2O2 — CID 143523299
methyl 6-amino-13-cycloheptyl-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxylate (PubChem CID 143523299) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is methyl 6-amino-13-cycloheptyl-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxylate.
| Compound Name | methyl 6-amino-13-cycloheptyl-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxylate |
|---|---|
| PubChem CID | 143523299 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | methyl 6-amino-13-cycloheptyl-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCCC3)c3n(c2c1)CC(N)Cc1ccccc1-3 |
| InChI | InChI=1S/C26H30N2O2/c1-30-26(29)19-12-13-22-23(15-19)28-16-20(27)14-18-10-6-7-11-21(18)25(28)24(22)17-8-4-2-3-5-9-17/h6-7,10-13,15,17,20H,2-5,8-9,14,16,27H2,1H3 |
| InChIKey | RFESCSNNCXNXLU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|