C25H25NO4 — CID 86640307
methyl 13-cyclohexyl-6-formyl-6,7-dihydroindolo[1,2-d][1,4]benzoxazepine-10-carboxylate (PubChem CID 86640307) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 13-cyclohexyl-6-formyl-6,7-dihydroindolo[1,2-d][1,4]benzoxazepine-10-carboxylate.
| Compound Name | methyl 13-cyclohexyl-6-formyl-6,7-dihydroindolo[1,2-d][1,4]benzoxazepine-10-carboxylate |
|---|---|
| PubChem CID | 86640307 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 13-cyclohexyl-6-formyl-6,7-dihydroindolo[1,2-d][1,4]benzoxazepine-10-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC(C=O)Oc1ccccc1-3 |
| InChI | InChI=1S/C25H25NO4/c1-29-25(28)17-11-12-19-21(13-17)26-14-18(15-27)30-22-10-6-5-9-20(22)24(26)23(19)16-7-3-2-4-8-16/h5-6,9-13,15-16,18H,2-4,7-8,14H2,1H3 |
| InChIKey | XCYBJBFPQZYOIR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|