C28H32N2O2 — CID 68706142
methyl 10-amino-21-cyclohexyl-14-azapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylate (PubChem CID 68706142) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is methyl 10-amino-21-cyclohexyl-14-azapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylate.
| Compound Name | methyl 10-amino-21-cyclohexyl-14-azapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylate |
|---|---|
| PubChem CID | 68706142 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | methyl 10-amino-21-cyclohexyl-14-azapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC1CC(N)CC1c1ccccc1-3 |
| InChI | InChI=1S/C28H32N2O2/c1-32-28(31)18-11-12-23-25(14-18)30-16-19-13-20(29)15-24(19)21-9-5-6-10-22(21)27(30)26(23)17-7-3-2-4-8-17/h5-6,9-12,14,17,19-20,24H,2-4,7-8,13,15-16,29H2,1H3 |
| InChIKey | FMCYACBVGNDSNQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |