C28H29NO4 — CID 102125984
dimethyl (10R)-19-cyclohexyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-10,15-dicarboxylate (PubChem CID 102125984) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is dimethyl (10R)-19-cyclohexyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-10,15-dicarboxylate.
| Compound Name | dimethyl (10R)-19-cyclohexyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-10,15-dicarboxylate |
|---|---|
| PubChem CID | 102125984 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | dimethyl (10R)-19-cyclohexyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-10,15-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)C[C@@]1(C(=O)OC)CC1c1ccccc1-3 |
| InChI | InChI=1S/C28H29NO4/c1-32-26(30)18-12-13-21-23(14-18)29-16-28(27(31)33-2)15-22(28)19-10-6-7-11-20(19)25(29)24(21)17-8-4-3-5-9-17/h6-7,10-14,17,22H,3-5,8-9,15-16H2,1-2H3/t22?,28-/m0/s1 |
| InChIKey | PCQBBMZCZUUFIJ-WNWQKLGWSA-N |
| XLogP | 5.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |