C29H35N3O5S2 — CID 23658075
19-cyclohexyl-N-(dimethylsulfamoyl)-10-ethylsulfonyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxamide (PubChem CID 23658075) has the molecular formula C29H35N3O5S2 and a molecular weight of 569.75 g/mol. Its IUPAC name is 19-cyclohexyl-N-(dimethylsulfamoyl)-10-ethylsulfonyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxamide.
| Compound Name | 19-cyclohexyl-N-(dimethylsulfamoyl)-10-ethylsulfonyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxamide |
|---|---|
| PubChem CID | 23658075 |
| Molecular Formula | C29H35N3O5S2 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 19-cyclohexyl-N-(dimethylsulfamoyl)-10-ethylsulfonyl-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxamide |
| SMILES | CCS(=O)(=O)C12CC1c1ccccc1-c1c(C3CCCCC3)c3ccc(C(=O)NS(=O)(=O)N(C)C)cc3n1C2 |
| InChI | InChI=1S/C29H35N3O5S2/c1-4-38(34,35)29-17-24(29)21-12-8-9-13-22(21)27-26(19-10-6-5-7-11-19)23-15-14-20(16-25(23)32(27)18-29)28(33)30-39(36,37)31(2)3/h8-9,12-16,19,24H,4-7,10-11,17-18H2,1-3H3,(H,30,33) |
| InChIKey | FHELYWHYAVOFER-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |