C28H27NO2 — CID 11774213
1-benzyl-3-cyclohexyl-2-phenylindole-5-carboxylic acid (PubChem CID 11774213) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-benzyl-3-cyclohexyl-2-phenylindole-5-carboxylic acid.
| Compound Name | 1-benzyl-3-cyclohexyl-2-phenylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 11774213 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-benzyl-3-cyclohexyl-2-phenylindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)c(C1CCCCC1)c(-c1ccccc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C28H27NO2/c30-28(31)23-16-17-25-24(18-23)26(21-12-6-2-7-13-21)27(22-14-8-3-9-15-22)29(25)19-20-10-4-1-5-11-20/h1,3-5,8-11,14-18,21H,2,6-7,12-13,19H2,(H,30,31) |
| InChIKey | LACUPSDUACSIPY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |