C30H29N5O3 — CID 11352690
3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(2H-tetrazol-5-ylmethyl)indole-6-carboxylic acid (PubChem CID 11352690) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(2H-tetrazol-5-ylmethyl)indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(2H-tetrazol-5-ylmethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 11352690 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(2H-tetrazol-5-ylmethyl)indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3ccc(OCc4ccccc4)cc3)n(Cc3nn[nH]n3)c2c1 |
| InChI | InChI=1S/C30H29N5O3/c36-30(37)23-13-16-25-26(17-23)35(18-27-31-33-34-32-27)29(28(25)21-9-5-2-6-10-21)22-11-14-24(15-12-22)38-19-20-7-3-1-4-8-20/h1,3-4,7-8,11-17,21H,2,5-6,9-10,18-19H2,(H,36,37)(H,31,32,33,34) |
| InChIKey | SLSVIEPPLUQVKX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |