C36H39N3O3 — CID 68506131
(7E)-17-cyclohexyl-18-(4-phenylmethoxyphenyl)-1,4,11-triazatricyclo[11.5.2.016,19]icosa-7,13(20),14,16(19),17-pentaene-3,12-dione (PubChem CID 68506131) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is (7E)-17-cyclohexyl-18-(4-phenylmethoxyphenyl)-1,4,11-triazatricyclo[11.5.2.016,19]icosa-7,13(20),14,16(19),17-pentaene-3,12-dione.
| Compound Name | (7E)-17-cyclohexyl-18-(4-phenylmethoxyphenyl)-1,4,11-triazatricyclo[11.5.2.016,19]icosa-7,13(20),14,16(19),17-pentaene-3,12-dione |
|---|---|
| PubChem CID | 68506131 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | (7E)-17-cyclohexyl-18-(4-phenylmethoxyphenyl)-1,4,11-triazatricyclo[11.5.2.016,19]icosa-7,13(20),14,16(19),17-pentaene-3,12-dione |
| SMILES | O=C1Cn2c(-c3ccc(OCc4ccccc4)cc3)c(C3CCCCC3)c3ccc(cc32)C(=O)NCC/C=C/CCN1 |
| InChI | InChI=1S/C36H39N3O3/c40-33-24-39-32-23-29(36(41)38-22-10-2-1-9-21-37-33)17-20-31(32)34(27-13-7-4-8-14-27)35(39)28-15-18-30(19-16-28)42-25-26-11-5-3-6-12-26/h1-3,5-6,11-12,15-20,23,27H,4,7-10,13-14,21-22,24-25H2,(H,37,40)(H,38,41)/b2-1+ |
| InChIKey | RHBIESICZMIZHA-OWOJBTEDSA-N |
| XLogP | 7.13 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|