C30H38N4O2S — CID 71072141
18-cyclohexyl-4,7-dimethyl-19-phenyl-11-thia-1,4,7,12-tetrazatricyclo[12.5.2.017,20]henicosa-14(21),15,17(20),18-tetraene-3,13-dione (PubChem CID 71072141) has the molecular formula C30H38N4O2S and a molecular weight of 518.73 g/mol. Its IUPAC name is 18-cyclohexyl-4,7-dimethyl-19-phenyl-11-thia-1,4,7,12-tetrazatricyclo[12.5.2.017,20]henicosa-14(21),15,17(20),18-tetraene-3,13-dione.
| Compound Name | 18-cyclohexyl-4,7-dimethyl-19-phenyl-11-thia-1,4,7,12-tetrazatricyclo[12.5.2.017,20]henicosa-14(21),15,17(20),18-tetraene-3,13-dione |
|---|---|
| PubChem CID | 71072141 |
| Molecular Formula | C30H38N4O2S |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 18-cyclohexyl-4,7-dimethyl-19-phenyl-11-thia-1,4,7,12-tetrazatricyclo[12.5.2.017,20]henicosa-14(21),15,17(20),18-tetraene-3,13-dione |
| SMILES | CN1CCCSNC(=O)c2ccc3c(C4CCCCC4)c(-c4ccccc4)n(c3c2)CC(=O)N(C)CC1 |
| InChI | InChI=1S/C30H38N4O2S/c1-32-16-9-19-37-31-30(36)24-14-15-25-26(20-24)34(21-27(35)33(2)18-17-32)29(23-12-7-4-8-13-23)28(25)22-10-5-3-6-11-22/h4,7-8,12-15,20,22H,3,5-6,9-11,16-19,21H2,1-2H3,(H,31,36) |
| InChIKey | IBKQZBYRUDLPKL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|