C27H26N2O2 — CID 11178349
3-cyclohexyl-2-phenyl-1-(pyridin-3-ylmethyl)indole-6-carboxylic acid (PubChem CID 11178349) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-cyclohexyl-2-phenyl-1-(pyridin-3-ylmethyl)indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-2-phenyl-1-(pyridin-3-ylmethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 11178349 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-cyclohexyl-2-phenyl-1-(pyridin-3-ylmethyl)indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3ccccc3)n(Cc3cccnc3)c2c1 |
| InChI | InChI=1S/C27H26N2O2/c30-27(31)22-13-14-23-24(16-22)29(18-19-8-7-15-28-17-19)26(21-11-5-2-6-12-21)25(23)20-9-3-1-4-10-20/h2,5-8,11-17,20H,1,3-4,9-10,18H2,(H,30,31) |
| InChIKey | AUADNRQSSVMZOU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |