C26H31NO2Y-2 — CID 161282807
3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;ethane;yttrium (PubChem CID 161282807) has the molecular formula C26H31NO2Y-2 and a molecular weight of 478.45 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;ethane;yttrium.
| Compound Name | 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;ethane;yttrium |
|---|---|
| PubChem CID | 161282807 |
| Molecular Formula | C26H31NO2Y-2 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-2-(2-methanidylphenyl)indole-6-carboxylic acid;ethane;yttrium |
| SMILES | CC.[CH2-]Cn1c(-c2ccccc2[CH2-])c(C2CCCCC2)c2ccc(C(=O)O)cc21.[Y] |
| InChI | InChI=1S/C24H25NO2.C2H6.Y/c1-3-25-21-15-18(24(26)27)13-14-20(21)22(17-10-5-4-6-11-17)23(25)19-12-8-7-9-16(19)2;1-2;/h7-9,12-15,17H,1-6,10-11H2,(H,26,27);1-2H3;/q-2;; |
| InChIKey | BRMYNPSTOMBDFN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|