C23H33BrN2O4 — CID 88586300
tert-butyl N-[2-[2-bromo-3-cyclohexyl-6-(methylperoxymethyl)indol-1-yl]ethyl]carbamate (PubChem CID 88586300) has the molecular formula C23H33BrN2O4 and a molecular weight of 481.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-bromo-3-cyclohexyl-6-(methylperoxymethyl)indol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-bromo-3-cyclohexyl-6-(methylperoxymethyl)indol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 88586300 |
| Molecular Formula | C23H33BrN2O4 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | tert-butyl N-[2-[2-bromo-3-cyclohexyl-6-(methylperoxymethyl)indol-1-yl]ethyl]carbamate |
| SMILES | COOCc1ccc2c(C3CCCCC3)c(Br)n(CCNC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C23H33BrN2O4/c1-23(2,3)30-22(27)25-12-13-26-19-14-16(15-29-28-4)10-11-18(19)20(21(26)24)17-8-6-5-7-9-17/h10-11,14,17H,5-9,12-13,15H2,1-4H3,(H,25,27) |
| InChIKey | QNDNZJQRHGWUTG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|