C21H33NO2S — CID 130357583
tert-butyl N-[2-[(4-cycloheptylphenyl)methylsulfanyl]ethyl]carbamate (PubChem CID 130357583) has the molecular formula C21H33NO2S and a molecular weight of 363.57 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-cycloheptylphenyl)methylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-cycloheptylphenyl)methylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 130357583 |
| Molecular Formula | C21H33NO2S |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl N-[2-[(4-cycloheptylphenyl)methylsulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCc1ccc(C2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H33NO2S/c1-21(2,3)24-20(23)22-14-15-25-16-17-10-12-19(13-11-17)18-8-6-4-5-7-9-18/h10-13,18H,4-9,14-16H2,1-3H3,(H,22,23) |
| InChIKey | YQEAUNWNKJOLNZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|