C19H28N2O3S — CID 39964873
tert-butyl (2R)-2-(2-benzylsulfanylethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 39964873) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-benzylsulfanylethylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(2-benzylsulfanylethylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 39964873 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | tert-butyl (2R)-2-(2-benzylsulfanylethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-19(2,3)24-18(23)21-12-7-10-16(21)17(22)20-11-13-25-14-15-8-5-4-6-9-15/h4-6,8-9,16H,7,10-14H2,1-3H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | MSZVGRLWGAINSO-MRXNPFEDSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|